C11H19ClN4O — CID 82253262
2-[3-(dimethylamino)propoxy]pyridine-3-carboximidamide;hydrochloride (PubChem CID 82253262) has the molecular formula C11H19ClN4O and a molecular weight of 258.75 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propoxy]pyridine-3-carboximidamide;hydrochloride.
| Compound Name | 2-[3-(dimethylamino)propoxy]pyridine-3-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 82253262 |
| Molecular Formula | C11H19ClN4O |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-[3-(dimethylamino)propoxy]pyridine-3-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccnc1OCCCN(C)C |
| InChI | InChI=1S/C11H18N4O.ClH/c1-15(2)7-4-8-16-11-9(10(12)13)5-3-6-14-11;/h3,5-6H,4,7-8H2,1-2H3,(H3,12,13);1H |
| InChIKey | JHBYNKYDADWPTL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|