C38H32AlF3O3Si2 — CID 139784756
triphenyl-[2,2,2-trifluoroethoxy(triphenylsilyloxy)alumanyl]oxysilane (PubChem CID 139784756) has the molecular formula C38H32AlF3O3Si2 and a molecular weight of 676.82 g/mol. Its IUPAC name is triphenyl-[2,2,2-trifluoroethoxy(triphenylsilyloxy)alumanyl]oxysilane.
| Compound Name | triphenyl-[2,2,2-trifluoroethoxy(triphenylsilyloxy)alumanyl]oxysilane |
|---|---|
| PubChem CID | 139784756 |
| Molecular Formula | C38H32AlF3O3Si2 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.17 |
| IUPAC Name | triphenyl-[2,2,2-trifluoroethoxy(triphenylsilyloxy)alumanyl]oxysilane |
| SMILES | FC(F)(F)CO[Al](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C18H15OSi.C2H2F3O.Al/c2*19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-2(4,5)1-6;/h2*1-15H;1H2;/q3*-1;+3 |
| InChIKey | GSZGBKKZGKORJO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|