C14H18Cl2Si — CID 139699551
dichloro-bis(3,4-dimethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 139699551) has the molecular formula C14H18Cl2Si and a molecular weight of 285.29 g/mol. Its IUPAC name is dichloro-bis(3,4-dimethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | dichloro-bis(3,4-dimethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 139699551 |
| Molecular Formula | C14H18Cl2Si |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | dichloro-bis(3,4-dimethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC([Si](Cl)(Cl)C2C=C(C)C(C)=C2)C=C1C |
| InChI | InChI=1S/C14H18Cl2Si/c1-9-5-13(6-10(9)2)17(15,16)14-7-11(3)12(4)8-14/h5-8,13-14H,1-4H3 |
| InChIKey | BDGQOZCRIWJATA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|