C29H30 — CID 157132628
1-[(3,4-dimethylcyclopenta-2,4-dien-1-yl)-bis(3-methylphenyl)methyl]-3-methylbenzene (PubChem CID 157132628) has the molecular formula C29H30 and a molecular weight of 378.56 g/mol. Its IUPAC name is 1-[(3,4-dimethylcyclopenta-2,4-dien-1-yl)-bis(3-methylphenyl)methyl]-3-methylbenzene.
| Compound Name | 1-[(3,4-dimethylcyclopenta-2,4-dien-1-yl)-bis(3-methylphenyl)methyl]-3-methylbenzene |
|---|---|
| PubChem CID | 157132628 |
| Molecular Formula | C29H30 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-[(3,4-dimethylcyclopenta-2,4-dien-1-yl)-bis(3-methylphenyl)methyl]-3-methylbenzene |
| SMILES | CC1=CC(C(c2cccc(C)c2)(c2cccc(C)c2)c2cccc(C)c2)C=C1C |
| InChI | InChI=1S/C29H30/c1-20-9-6-12-25(15-20)29(26-13-7-10-21(2)16-26,27-14-8-11-22(3)17-27)28-18-23(4)24(5)19-28/h6-19,28H,1-5H3 |
| InChIKey | VEZZCNHBGPEXDG-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|