C34H38P2 — CID 19367737
[[2-[bis(3-methylphenyl)-phosphanylmethyl]cyclobutyl]-bis(3-methylphenyl)methyl]phosphane (PubChem CID 19367737) has the molecular formula C34H38P2 and a molecular weight of 508.63 g/mol. Its IUPAC name is [[2-[bis(3-methylphenyl)-phosphanylmethyl]cyclobutyl]-bis(3-methylphenyl)methyl]phosphane.
| Compound Name | [[2-[bis(3-methylphenyl)-phosphanylmethyl]cyclobutyl]-bis(3-methylphenyl)methyl]phosphane |
|---|---|
| PubChem CID | 19367737 |
| Molecular Formula | C34H38P2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | [[2-[bis(3-methylphenyl)-phosphanylmethyl]cyclobutyl]-bis(3-methylphenyl)methyl]phosphane |
| SMILES | Cc1cccc(C(P)(c2cccc(C)c2)C2CCC2C(P)(c2cccc(C)c2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C34H38P2/c1-23-9-5-13-27(19-23)33(35,28-14-6-10-24(2)20-28)31-17-18-32(31)34(36,29-15-7-11-25(3)21-29)30-16-8-12-26(4)22-30/h5-16,19-22,31-32H,17-18,35-36H2,1-4H3 |
| InChIKey | NJQMZTSLADISPV-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|