C23H25P — CID 155600016
1,1,2-tris(3-methylphenyl)ethylphosphane (PubChem CID 155600016) has the molecular formula C23H25P and a molecular weight of 332.43 g/mol. Its IUPAC name is 1,1,2-tris(3-methylphenyl)ethylphosphane.
| Compound Name | 1,1,2-tris(3-methylphenyl)ethylphosphane |
|---|---|
| PubChem CID | 155600016 |
| Molecular Formula | C23H25P |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1,1,2-tris(3-methylphenyl)ethylphosphane |
| SMILES | Cc1cccc(CC(P)(c2cccc(C)c2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C23H25P/c1-17-7-4-10-20(13-17)16-23(24,21-11-5-8-18(2)14-21)22-12-6-9-19(3)15-22/h4-15H,16,24H2,1-3H3 |
| InChIKey | CKGYGZLXHVXGDS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|