C17H20O — CID 60798209
1,2-bis(3-methylphenyl)propan-2-ol (PubChem CID 60798209) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 1,2-bis(3-methylphenyl)propan-2-ol.
| Compound Name | 1,2-bis(3-methylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 60798209 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1,2-bis(3-methylphenyl)propan-2-ol |
| SMILES | Cc1cccc(CC(C)(O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C17H20O/c1-13-6-4-8-15(10-13)12-17(3,18)16-9-5-7-14(2)11-16/h4-11,18H,12H2,1-3H3 |
| InChIKey | PFXLSBWDISOPRN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |