C11H12F4 — CID 159642722
1-methyl-3-(2,2,3,3-tetrafluorobutyl)benzene (PubChem CID 159642722) has the molecular formula C11H12F4 and a molecular weight of 220.21 g/mol. Its IUPAC name is 1-methyl-3-(2,2,3,3-tetrafluorobutyl)benzene.
| Compound Name | 1-methyl-3-(2,2,3,3-tetrafluorobutyl)benzene |
|---|---|
| PubChem CID | 159642722 |
| Molecular Formula | C11H12F4 |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1-methyl-3-(2,2,3,3-tetrafluorobutyl)benzene |
| SMILES | Cc1cccc(CC(F)(F)C(C)(F)F)c1 |
| InChI | InChI=1S/C11H12F4/c1-8-4-3-5-9(6-8)7-11(14,15)10(2,12)13/h3-6H,7H2,1-2H3 |
| InChIKey | WCUNDRDRWIVTLA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|