C26H28 — CID 143472200
1-[2,2-bis(3-methylphenyl)propyl]-3-prop-1-en-2-ylbenzene (PubChem CID 143472200) has the molecular formula C26H28 and a molecular weight of 340.51 g/mol. Its IUPAC name is 1-[2,2-bis(3-methylphenyl)propyl]-3-prop-1-en-2-ylbenzene.
| Compound Name | 1-[2,2-bis(3-methylphenyl)propyl]-3-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 143472200 |
| Molecular Formula | C26H28 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-[2,2-bis(3-methylphenyl)propyl]-3-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1cccc(CC(C)(c2cccc(C)c2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C26H28/c1-19(2)23-12-8-11-22(17-23)18-26(5,24-13-6-9-20(3)15-24)25-14-7-10-21(4)16-25/h6-17H,1,18H2,2-5H3 |
| InChIKey | BAXSYIRBVWFYHF-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |