C20H32O2 — CID 175999840
1,3-bis(prop-1-en-2-yl)benzene;2-tert-butylperoxy-2-methylpropane (PubChem CID 175999840) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 1,3-bis(prop-1-en-2-yl)benzene;2-tert-butylperoxy-2-methylpropane.
| Compound Name | 1,3-bis(prop-1-en-2-yl)benzene;2-tert-butylperoxy-2-methylpropane |
|---|---|
| PubChem CID | 175999840 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1,3-bis(prop-1-en-2-yl)benzene;2-tert-butylperoxy-2-methylpropane |
| SMILES | C=C(C)c1cccc(C(=C)C)c1.CC(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C12H14.C8H18O2/c1-9(2)11-6-5-7-12(8-11)10(3)4;1-7(2,3)9-10-8(4,5)6/h5-8H,1,3H2,2,4H3;1-6H3 |
| InChIKey | ZMDWGCPKJPHDFI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|