C32H46O2 — CID 174913877
1-prop-1-en-2-yl-3-[2-[2-(3-prop-1-en-2-ylphenyl)heptan-2-ylperoxy]heptan-2-yl]benzene (PubChem CID 174913877) has the molecular formula C32H46O2 and a molecular weight of 462.72 g/mol. Its IUPAC name is 1-prop-1-en-2-yl-3-[2-[2-(3-prop-1-en-2-ylphenyl)heptan-2-ylperoxy]heptan-2-yl]benzene.
| Compound Name | 1-prop-1-en-2-yl-3-[2-[2-(3-prop-1-en-2-ylphenyl)heptan-2-ylperoxy]heptan-2-yl]benzene |
|---|---|
| PubChem CID | 174913877 |
| Molecular Formula | C32H46O2 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | 1-prop-1-en-2-yl-3-[2-[2-(3-prop-1-en-2-ylphenyl)heptan-2-ylperoxy]heptan-2-yl]benzene |
| SMILES | C=C(C)c1cccc(C(C)(CCCCC)OOC(C)(CCCCC)c2cccc(C(=C)C)c2)c1 |
| InChI | InChI=1S/C32H46O2/c1-9-11-13-21-31(7,29-19-15-17-27(23-29)25(3)4)33-34-32(8,22-14-12-10-2)30-20-16-18-28(24-30)26(5)6/h15-20,23-24H,3,5,9-14,21-22H2,1-2,4,6-8H3 |
| InChIKey | JEVQHGGMKXZYFP-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|