C16H22Li+ — CID 158400502
lithium;1,3-bis(prop-1-en-2-yl)benzene;butane (PubChem CID 158400502) has the molecular formula C16H22Li+ and a molecular weight of 221.29 g/mol. Its IUPAC name is lithium;1,3-bis(prop-1-en-2-yl)benzene;butane.
| Compound Name | lithium;1,3-bis(prop-1-en-2-yl)benzene;butane |
|---|---|
| PubChem CID | 158400502 |
| Molecular Formula | C16H22Li+ |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | lithium;1,3-bis(prop-1-en-2-yl)benzene;butane |
| SMILES | C=C(C)c1cccc(C(=C)C)c1.[CH2+]C[CH-]C.[Li+] |
| InChI | InChI=1S/C12H14.C4H8.Li/c1-9(2)11-6-5-7-12(8-11)10(3)4;1-3-4-2;/h5-8H,1,3H2,2,4H3;4H,1,3H2,2H3;/q;;+1 |
| InChIKey | BWGMSNYUYKOCDE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|