About lithium;1,3-bis(prop-1-en-2-yl)benzene;butane
lithium;1,3-bis(prop-1-en-2-yl)benzene;butane (PubChem CID 158400502) has the molecular formula C16H22Li+
and a molecular weight of 221.29 g/mol. Its IUPAC name is lithium;1,3-bis(prop-1-en-2-yl)benzene;butane.
Molecular Properties
| Compound Name | lithium;1,3-bis(prop-1-en-2-yl)benzene;butane |
| PubChem CID | 158400502 |
| Molecular Formula | C16H22Li+ |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | lithium;1,3-bis(prop-1-en-2-yl)benzene;butane |
| SMILES | C=C(C)c1cccc(C(=C)C)c1.[CH2+]C[CH-]C.[Li+] |
| InChI | InChI=1S/C12H14.C4H8.Li/c1-9(2)11-6-5-7-12(8-11)10(3)4;1-3-4-2;/h5-8H,1,3H2,2,4H3;4H,1,3H2,2H3;/q;;+1 |
| InChIKey | BWGMSNYUYKOCDE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;1,3-bis(prop-1-en-2-yl)benzene;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1,3-bis(prop-1-en-2-yl)benzene;butane?
The IUPAC name of lithium;1,3-bis(prop-1-en-2-yl)benzene;butane (CID 158400502) is lithium;1,3-bis(prop-1-en-2-yl)benzene;butane.
What is the SMILES notation for lithium;1,3-bis(prop-1-en-2-yl)benzene;butane?
The canonical SMILES for lithium;1,3-bis(prop-1-en-2-yl)benzene;butane is C=C(C)c1cccc(C(=C)C)c1.[CH2+]C[CH-]C.[Li+].
What is the InChIKey of lithium;1,3-bis(prop-1-en-2-yl)benzene;butane?
The InChIKey is BWGMSNYUYKOCDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14.C4H8.Li/c1-9(2)11-6-5-7-12(8-11)10(3)4;1-3-4-2;/h5-8H,1,3H2,2,4H3;4H,1,3H2,2H3;/q;;+1.
What are the key properties of lithium;1,3-bis(prop-1-en-2-yl)benzene;butane?
lithium;1,3-bis(prop-1-en-2-yl)benzene;butane has a molecular weight of 221.29 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1,3-bis(prop-1-en-2-yl)benzene;butane is sourced from PubChem (CID 158400502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).