C20H30O — CID 142555412
1,3-bis(prop-1-en-2-yl)benzene;2-methoxy-4,4-dimethylpent-1-ene (PubChem CID 142555412) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 1,3-bis(prop-1-en-2-yl)benzene;2-methoxy-4,4-dimethylpent-1-ene.
| Compound Name | 1,3-bis(prop-1-en-2-yl)benzene;2-methoxy-4,4-dimethylpent-1-ene |
|---|---|
| PubChem CID | 142555412 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 1,3-bis(prop-1-en-2-yl)benzene;2-methoxy-4,4-dimethylpent-1-ene |
| SMILES | C=C(C)c1cccc(C(=C)C)c1.C=C(CC(C)(C)C)OC |
| InChI | InChI=1S/C12H14.C8H16O/c1-9(2)11-6-5-7-12(8-11)10(3)4;1-7(9-5)6-8(2,3)4/h5-8H,1,3H2,2,4H3;1,6H2,2-5H3 |
| InChIKey | LYSJULKRTPRMJU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|