About CID 23599187
CID 23599187 (PubChem CID 23599187) has the molecular formula C9H9Ge
and a molecular weight of 189.78 g/mol.
Molecular Properties
| Compound Name | CID 23599187 |
| PubChem CID | 23599187 |
| Molecular Formula | C9H9Ge |
| Molecular Weight | 189.78 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | — |
| SMILES | C=C(C)c1cccc([Ge])c1 |
| InChI | InChI=1S/C9H9Ge/c1-7(2)8-4-3-5-9(10)6-8/h3-6H,1H2,2H3 |
| InChIKey | IEWOTQZWTDKCOV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.78 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 23599187 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23599187?
The IUPAC name of CID 23599187 (CID 23599187) is not available.
What is the SMILES notation for CID 23599187?
The canonical SMILES for CID 23599187 is C=C(C)c1cccc([Ge])c1.
What is the InChIKey of CID 23599187?
The InChIKey is IEWOTQZWTDKCOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Ge/c1-7(2)8-4-3-5-9(10)6-8/h3-6H,1H2,2H3.
What are the key properties of CID 23599187?
CID 23599187 has a molecular weight of 189.78 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23599187 is sourced from PubChem (CID 23599187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).