C22H32Si — CID 139978462
cyclopenta-2,4-dien-1-yl-(2,4-dicyclopentylcyclopenta-2,4-dien-1-yl)-dimethylsilane (PubChem CID 139978462) has the molecular formula C22H32Si and a molecular weight of 324.58 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-(2,4-dicyclopentylcyclopenta-2,4-dien-1-yl)-dimethylsilane.
| Compound Name | cyclopenta-2,4-dien-1-yl-(2,4-dicyclopentylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 139978462 |
| Molecular Formula | C22H32Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-(2,4-dicyclopentylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
| SMILES | C[Si](C)(C1C=CC=C1)C1C=C(C2CCCC2)C=C1C1CCCC1 |
| InChI | InChI=1S/C22H32Si/c1-23(2,20-13-7-8-14-20)22-16-19(17-9-3-4-10-17)15-21(22)18-11-5-6-12-18/h7-8,13-18,20,22H,3-6,9-12H2,1-2H3 |
| InChIKey | FDOPYOJSVQRTBP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|