C21H36N2Si — CID 58634112
(4-cyclohexyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethyl-piperazin-1-ylsilane (PubChem CID 58634112) has the molecular formula C21H36N2Si and a molecular weight of 344.62 g/mol. Its IUPAC name is (4-cyclohexyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethyl-piperazin-1-ylsilane.
| Compound Name | (4-cyclohexyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethyl-piperazin-1-ylsilane |
|---|---|
| PubChem CID | 58634112 |
| Molecular Formula | C21H36N2Si |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (4-cyclohexyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethyl-piperazin-1-ylsilane |
| SMILES | C[Si](C)(C1CCC2C(C3CCCCC3)=CC=CC21)N1CCNCC1 |
| InChI | InChI=1S/C21H36N2Si/c1-24(2,23-15-13-22-14-16-23)21-12-11-19-18(9-6-10-20(19)21)17-7-4-3-5-8-17/h6,9-10,17,19-22H,3-5,7-8,11-16H2,1-2H3 |
| InChIKey | AJFCJHFOKOCQDR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|