C21H30N2Si — CID 58634122
dimethyl-(2-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-piperazin-1-ylsilane (PubChem CID 58634122) has the molecular formula C21H30N2Si and a molecular weight of 338.57 g/mol. Its IUPAC name is dimethyl-(2-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-piperazin-1-ylsilane.
| Compound Name | dimethyl-(2-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-piperazin-1-ylsilane |
|---|---|
| PubChem CID | 58634122 |
| Molecular Formula | C21H30N2Si |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | dimethyl-(2-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-piperazin-1-ylsilane |
| SMILES | C[Si](C)(C1C(c2ccccc2)CC2C=CC=CC21)N1CCNCC1 |
| InChI | InChI=1S/C21H30N2Si/c1-24(2,23-14-12-22-13-15-23)21-19-11-7-6-10-18(19)16-20(21)17-8-4-3-5-9-17/h3-11,18-22H,12-16H2,1-2H3 |
| InChIKey | PHWDVZIVBGXSLH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|