C18H22 — CID 21095760
2-phenyl-1-propyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 21095760) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-phenyl-1-propyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 2-phenyl-1-propyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 21095760 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-phenyl-1-propyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CCCC1C(c2ccccc2)CC2C=CC=CC21 |
| InChI | InChI=1S/C18H22/c1-2-8-17-16-12-7-6-11-15(16)13-18(17)14-9-4-3-5-10-14/h3-7,9-12,15-18H,2,8,13H2,1H3 |
| InChIKey | RHBFRFXMJLZQAT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |