About 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride
2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride (PubChem CID 45264199) has the molecular formula C15H24ClN
and a molecular weight of 253.82 g/mol. Its IUPAC name is 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride |
| PubChem CID | 45264199 |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.82 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride |
| SMILES | CCCN(CCC)C1CC1c1ccccc1.Cl |
| InChI | InChI=1S/C15H23N.ClH/c1-3-10-16(11-4-2)15-12-14(15)13-8-6-5-7-9-13;/h5-9,14-15H,3-4,10-12H2,1-2H3;1H |
| InChIKey | UENPHHSJWOAIHJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride?
The IUPAC name of 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride (CID 45264199) is 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride.
What is the SMILES notation for 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride?
The canonical SMILES for 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride is CCCN(CCC)C1CC1c1ccccc1.Cl.
What is the InChIKey of 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride?
The InChIKey is UENPHHSJWOAIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N.ClH/c1-3-10-16(11-4-2)15-12-14(15)13-8-6-5-7-9-13;/h5-9,14-15H,3-4,10-12H2,1-2H3;1H.
What are the key properties of 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride?
2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride has a molecular weight of 253.82 g/mol, XLogP of 4.09, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-N,N-dipropylcyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 45264199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).