C20H29N3Si — CID 76843825
dimethyl-(3-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-(1,3,5-triazinan-1-yl)silane (PubChem CID 76843825) has the molecular formula C20H29N3Si and a molecular weight of 339.56 g/mol. Its IUPAC name is dimethyl-(3-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-(1,3,5-triazinan-1-yl)silane.
| Compound Name | dimethyl-(3-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-(1,3,5-triazinan-1-yl)silane |
|---|---|
| PubChem CID | 76843825 |
| Molecular Formula | C20H29N3Si |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | dimethyl-(3-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-(1,3,5-triazinan-1-yl)silane |
| SMILES | C[Si](C)(C1CC(c2ccccc2)C2C=CC=CC21)N1CNCNC1 |
| InChI | InChI=1S/C20H29N3Si/c1-24(2,23-14-21-13-22-15-23)20-12-19(16-8-4-3-5-9-16)17-10-6-7-11-18(17)20/h3-11,17-22H,12-15H2,1-2H3 |
| InChIKey | KZXPUHLJFVDUCJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|