C22H32Cl2N3SiTi+ — CID 58634677
1-aza-3,5-diazanidacyclohex-1-yl-[(3S)-3-benzyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane;carbanide;dichlorotitanium(4+) (PubChem CID 58634677) has the molecular formula C22H32Cl2N3SiTi+ and a molecular weight of 485.38 g/mol. Its IUPAC name is 1-aza-3,5-diazanidacyclohex-1-yl-[(3S)-3-benzyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane;carbanide;dichlorotitanium(4+).
| Compound Name | 1-aza-3,5-diazanidacyclohex-1-yl-[(3S)-3-benzyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane;carbanide;dichlorotitanium(4+) |
|---|---|
| PubChem CID | 58634677 |
| Molecular Formula | C22H32Cl2N3SiTi+ |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 1-aza-3,5-diazanidacyclohex-1-yl-[(3S)-3-benzyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane;carbanide;dichlorotitanium(4+) |
| SMILES | C[Si](C)(C1C[C@H](Cc2ccccc2)C2C=CC=CC21)N1C[N-]C[N-]C1.Cl[Ti+4]Cl.[CH3-] |
| InChI | InChI=1S/C21H29N3Si.CH3.2ClH.Ti/c1-25(2,24-15-22-14-23-16-24)21-13-18(12-17-8-4-3-5-9-17)19-10-6-7-11-20(19)21;;;;/h3-11,18-21H,12-16H2,1-2H3;1H3;2*1H;/q-2;-1;;;+6/p-2/t18-,19?,20?,21?;;;;/m0..../s1 |
| InChIKey | YXCLAQADMAWORB-BVKCIQAZSA-L |
| XLogP | 6.94 |
| TPSA | 31.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|