C14H19NO2S — CID 15668312
(4S)-4-benzyl-3-tert-butylsulfanyl-1,3-oxazolidin-2-one (PubChem CID 15668312) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is (4S)-4-benzyl-3-tert-butylsulfanyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-tert-butylsulfanyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15668312 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (4S)-4-benzyl-3-tert-butylsulfanyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)SN1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO2S/c1-14(2,3)18-15-12(10-17-13(15)16)9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | WHSBIXNCIIUNKI-LBPRGKRZSA-N |
| XLogP | 3.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|