C11H11NO3 — CID 10774601
(4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbaldehyde (PubChem CID 10774601) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbaldehyde.
| Compound Name | (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 10774601 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbaldehyde |
| SMILES | O=CN1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C11H11NO3/c13-8-12-10(7-15-11(12)14)6-9-4-2-1-3-5-9/h1-5,8,10H,6-7H2/t10-/m1/s1 |
| InChIKey | UODUAYSQQJSKOS-SNVBAGLBSA-N |
| XLogP | 1.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|