C22H32Cl2N2SiTi-2 — CID 58634315
carbanide;dichlorotitanium;dimethyl-[(3S)-3-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-piperazin-4-id-1-ylsilane (PubChem CID 58634315) has the molecular formula C22H32Cl2N2SiTi-2 and a molecular weight of 471.37 g/mol. Its IUPAC name is carbanide;dichlorotitanium;dimethyl-[(3S)-3-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-piperazin-4-id-1-ylsilane.
| Compound Name | carbanide;dichlorotitanium;dimethyl-[(3S)-3-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-piperazin-4-id-1-ylsilane |
|---|---|
| PubChem CID | 58634315 |
| Molecular Formula | C22H32Cl2N2SiTi-2 |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | carbanide;dichlorotitanium;dimethyl-[(3S)-3-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-piperazin-4-id-1-ylsilane |
| SMILES | C[Si](C)(C1C[C@H](c2ccccc2)C2C=CC=CC21)N1CC[N-]CC1.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C21H29N2Si.CH3.2ClH.Ti/c1-24(2,23-14-12-22-13-15-23)21-16-20(17-8-4-3-5-9-17)18-10-6-7-11-19(18)21;;;;/h3-11,18-21H,12-16H2,1-2H3;1H3;2*1H;/q2*-1;;;+2/p-2/t18?,19?,20-,21?;;;;/m1..../s1 |
| InChIKey | IYGNEXUUULVPFC-RPIACTKVSA-L |
| XLogP | 6.62 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|