C12H20N2 — CID 57286917
5-cyclohexyl-2-methyl-2,3-dihydropyridin-3-amine (PubChem CID 57286917) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 5-cyclohexyl-2-methyl-2,3-dihydropyridin-3-amine.
| Compound Name | 5-cyclohexyl-2-methyl-2,3-dihydropyridin-3-amine |
|---|---|
| PubChem CID | 57286917 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 5-cyclohexyl-2-methyl-2,3-dihydropyridin-3-amine |
| SMILES | CC1N=CC(C2CCCCC2)=CC1N |
| InChI | InChI=1S/C12H20N2/c1-9-12(13)7-11(8-14-9)10-5-3-2-4-6-10/h7-10,12H,2-6,13H2,1H3 |
| InChIKey | HVACOSOZXRKTNZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |