C13H20 — CID 159952981
3-cyclopentyl-1-propan-2-ylcyclopenta-1,3-diene (PubChem CID 159952981) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 3-cyclopentyl-1-propan-2-ylcyclopenta-1,3-diene.
| Compound Name | 3-cyclopentyl-1-propan-2-ylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 159952981 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 3-cyclopentyl-1-propan-2-ylcyclopenta-1,3-diene |
| SMILES | CC(C)C1=CC(C2CCCC2)=CC1 |
| InChI | InChI=1S/C13H20/c1-10(2)12-7-8-13(9-12)11-5-3-4-6-11/h8-11H,3-7H2,1-2H3 |
| InChIKey | FDSORZKSMNYXDQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |