C10H17NO — CID 142450092
4-cyclopentyl-1,2-oxazole;ethane (PubChem CID 142450092) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 4-cyclopentyl-1,2-oxazole;ethane.
| Compound Name | 4-cyclopentyl-1,2-oxazole;ethane |
|---|---|
| PubChem CID | 142450092 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4-cyclopentyl-1,2-oxazole;ethane |
| SMILES | CC.c1nocc1C1CCCC1 |
| InChI | InChI=1S/C8H11NO.C2H6/c1-2-4-7(3-1)8-5-9-10-6-8;1-2/h5-7H,1-4H2;1-2H3 |
| InChIKey | BQIOCXZHACMJKM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |