C8H11NO — CID 142450093
4-cyclopentyl-1,2-oxazole (PubChem CID 142450093) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 4-cyclopentyl-1,2-oxazole.
| Compound Name | 4-cyclopentyl-1,2-oxazole |
|---|---|
| PubChem CID | 142450093 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 4-cyclopentyl-1,2-oxazole |
| SMILES | c1nocc1C1CCCC1 |
| InChI | InChI=1S/C8H11NO/c1-2-4-7(3-1)8-5-9-10-6-8/h5-7H,1-4H2 |
| InChIKey | BXPJDQAAMCOMGB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |