C13H18Si — CID 101180934
cyclopenta-2,4-dien-1-yl-dimethyl-(3-methylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 101180934) has the molecular formula C13H18Si and a molecular weight of 202.37 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-dimethyl-(3-methylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | cyclopenta-2,4-dien-1-yl-dimethyl-(3-methylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 101180934 |
| Molecular Formula | C13H18Si |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-dimethyl-(3-methylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC([Si](C)(C)C2C=CC=C2)C=C1 |
| InChI | InChI=1S/C13H18Si/c1-11-8-9-13(10-11)14(2,3)12-6-4-5-7-12/h4-10,12-13H,1-3H3 |
| InChIKey | BKQQGHODHYJZFL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|