C20H38Si2 — CID 101039275
tert-butyl-[(2Z,4Z,7Z)-6-[tert-butyl(dimethyl)silyl]cycloocta-2,4,7-trien-1-yl]-dimethylsilane (PubChem CID 101039275) has the molecular formula C20H38Si2 and a molecular weight of 334.70 g/mol. Its IUPAC name is tert-butyl-[(2Z,4Z,7Z)-6-[tert-butyl(dimethyl)silyl]cycloocta-2,4,7-trien-1-yl]-dimethylsilane.
| Compound Name | tert-butyl-[(2Z,4Z,7Z)-6-[tert-butyl(dimethyl)silyl]cycloocta-2,4,7-trien-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 101039275 |
| Molecular Formula | C20H38Si2 |
| Molecular Weight | 334.70 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | tert-butyl-[(2Z,4Z,7Z)-6-[tert-butyl(dimethyl)silyl]cycloocta-2,4,7-trien-1-yl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C1/C=C\C=C/C([Si](C)(C)C(C)(C)C)/C=C\1 |
| InChI | InChI=1S/C20H38Si2/c1-19(2,3)21(7,8)17-13-11-12-14-18(16-15-17)22(9,10)20(4,5)6/h11-18H,1-10H3/b13-11-,14-12-,16-15- |
| InChIKey | YUGOGPNGXGCYDN-DYVMWCOHSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.70 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|