C12H17P — CID 12844067
(2Z,4Z,6Z)-9-tert-butyl-9-phosphabicyclo[6.1.0]nona-2,4,6-triene (PubChem CID 12844067) has the molecular formula C12H17P and a molecular weight of 192.24 g/mol. Its IUPAC name is (2Z,4Z,6Z)-9-tert-butyl-9-phosphabicyclo[6.1.0]nona-2,4,6-triene.
| Compound Name | (2Z,4Z,6Z)-9-tert-butyl-9-phosphabicyclo[6.1.0]nona-2,4,6-triene |
|---|---|
| PubChem CID | 12844067 |
| Molecular Formula | C12H17P |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | (2Z,4Z,6Z)-9-tert-butyl-9-phosphabicyclo[6.1.0]nona-2,4,6-triene |
| SMILES | CC(C)(C)P1C2/C=C\C=C/C=C\C21 |
| InChI | InChI=1S/C12H17P/c1-12(2,3)13-10-8-6-4-5-7-9-11(10)13/h4-11H,1-3H3/b5-4-,8-6-,9-7- |
| InChIKey | XLLSOSSMXHGUDC-CBYRLPPOSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|