C18H41PSi2 — CID 15001525
tert-butyl-[(2R,3R)-1-tert-butyl-3-[tert-butyl(dimethyl)silyl]phosphiran-2-yl]-dimethylsilane (PubChem CID 15001525) has the molecular formula C18H41PSi2 and a molecular weight of 344.67 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-1-tert-butyl-3-[tert-butyl(dimethyl)silyl]phosphiran-2-yl]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R)-1-tert-butyl-3-[tert-butyl(dimethyl)silyl]phosphiran-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 15001525 |
| Molecular Formula | C18H41PSi2 |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | tert-butyl-[(2R,3R)-1-tert-butyl-3-[tert-butyl(dimethyl)silyl]phosphiran-2-yl]-dimethylsilane |
| SMILES | CC(C)(C)P1[C@@H]([Si](C)(C)C(C)(C)C)[C@@H]1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H41PSi2/c1-16(2,3)19-14(20(10,11)17(4,5)6)15(19)21(12,13)18(7,8)9/h14-15H,1-13H3/t14-,15-/m0/s1 |
| InChIKey | YNLFTVWTKJLZLS-GJZGRUSLSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|