C17H33OP — CID 101418775
(2S,6S)-1,2,6-tritert-butylphosphinan-4-one (PubChem CID 101418775) has the molecular formula C17H33OP and a molecular weight of 284.42 g/mol. Its IUPAC name is (2S,6S)-1,2,6-tritert-butylphosphinan-4-one.
| Compound Name | (2S,6S)-1,2,6-tritert-butylphosphinan-4-one |
|---|---|
| PubChem CID | 101418775 |
| Molecular Formula | C17H33OP |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | (2S,6S)-1,2,6-tritert-butylphosphinan-4-one |
| SMILES | CC(C)(C)[C@@H]1CC(=O)C[C@@H](C(C)(C)C)P1C(C)(C)C |
| InChI | InChI=1S/C17H33OP/c1-15(2,3)13-10-12(18)11-14(16(4,5)6)19(13)17(7,8)9/h13-14H,10-11H2,1-9H3/t13-,14-/m0/s1 |
| InChIKey | BDKLJIAJBYJZPB-KBPBESRZSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|