C21H42O — CID 157284508
1,2-ditert-butylcyclopropane;2,3-ditert-butyloxirane (PubChem CID 157284508) has the molecular formula C21H42O and a molecular weight of 310.57 g/mol. Its IUPAC name is 1,2-ditert-butylcyclopropane;2,3-ditert-butyloxirane.
| Compound Name | 1,2-ditert-butylcyclopropane;2,3-ditert-butyloxirane |
|---|---|
| PubChem CID | 157284508 |
| Molecular Formula | C21H42O |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.32 |
| IUPAC Name | 1,2-ditert-butylcyclopropane;2,3-ditert-butyloxirane |
| SMILES | CC(C)(C)C1CC1C(C)(C)C.CC(C)(C)C1OC1C(C)(C)C |
| InChI | InChI=1S/C11H22.C10H20O/c1-10(2,3)8-7-9(8)11(4,5)6;1-9(2,3)7-8(11-7)10(4,5)6/h8-9H,7H2,1-6H3;7-8H,1-6H3 |
| InChIKey | BABHPSRHSVKUOB-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|