C9H18O4 — CID 118459215
(4S,5R)-2-tert-butyloxane-3,4,5-triol (PubChem CID 118459215) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (4S,5R)-2-tert-butyloxane-3,4,5-triol.
| Compound Name | (4S,5R)-2-tert-butyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 118459215 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (4S,5R)-2-tert-butyloxane-3,4,5-triol |
| SMILES | CC(C)(C)C1OC[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C9H18O4/c1-9(2,3)8-7(12)6(11)5(10)4-13-8/h5-8,10-12H,4H2,1-3H3/t5-,6+,7?,8?/m1/s1 |
| InChIKey | VDAXVKXRZWKZRE-NYOFMCRDSA-N |
| XLogP | -0.49 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |