About (3S,4R)-(313C)oxolane-2,3,4-triol
(3S,4R)-(313C)oxolane-2,3,4-triol (PubChem CID 90472722) has the molecular formula C4H8O4
and a molecular weight of 121.10 g/mol. Its IUPAC name is (3S,4R)-(313C)oxolane-2,3,4-triol.
Molecular Properties
| Compound Name | (3S,4R)-(313C)oxolane-2,3,4-triol |
| PubChem CID | 90472722 |
| Molecular Formula | C4H8O4 |
| Molecular Weight | 121.10 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | (3S,4R)-(313C)oxolane-2,3,4-triol |
| SMILES | OC1OC[C@@H](O)[13C@@H]1O |
| InChI | InChI=1S/C4H8O4/c5-2-1-8-4(7)3(2)6/h2-7H,1H2/t2-,3+,4?/m1/s1/i3+1 |
| InChIKey | FMAORJIQYMIRHF-QLUVSIKNSA-N |
| XLogP | -1.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.10 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4R)-(313C)oxolane-2,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-(313C)oxolane-2,3,4-triol?
The IUPAC name of (3S,4R)-(313C)oxolane-2,3,4-triol (CID 90472722) is (3S,4R)-(313C)oxolane-2,3,4-triol.
What is the SMILES notation for (3S,4R)-(313C)oxolane-2,3,4-triol?
The canonical SMILES for (3S,4R)-(313C)oxolane-2,3,4-triol is OC1OC[C@@H](O)[13C@@H]1O.
What is the InChIKey of (3S,4R)-(313C)oxolane-2,3,4-triol?
The InChIKey is FMAORJIQYMIRHF-QLUVSIKNSA-N. The full InChI is InChI=1S/C4H8O4/c5-2-1-8-4(7)3(2)6/h2-7H,1H2/t2-,3+,4?/m1/s1/i3+1.
What are the key properties of (3S,4R)-(313C)oxolane-2,3,4-triol?
(3S,4R)-(313C)oxolane-2,3,4-triol has a molecular weight of 121.10 g/mol, XLogP of -1.94, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-(313C)oxolane-2,3,4-triol is sourced from PubChem (CID 90472722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).