C7H15NO4 — CID 123166220
4-(dimethylamino)oxane-2,3,5-triol (PubChem CID 123166220) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is 4-(dimethylamino)oxane-2,3,5-triol.
| Compound Name | 4-(dimethylamino)oxane-2,3,5-triol |
|---|---|
| PubChem CID | 123166220 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 4-(dimethylamino)oxane-2,3,5-triol |
| SMILES | CN(C)C1C(O)COC(O)C1O |
| InChI | InChI=1S/C7H15NO4/c1-8(2)5-4(9)3-12-7(11)6(5)10/h4-7,9-11H,3H2,1-2H3 |
| InChIKey | OUDVNTCOLCNHLV-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |