C10H20O3 — CID 20758663
2-tert-butyl-6-methyloxane-3,4-diol (PubChem CID 20758663) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-tert-butyl-6-methyloxane-3,4-diol.
| Compound Name | 2-tert-butyl-6-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 20758663 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 2-tert-butyl-6-methyloxane-3,4-diol |
| SMILES | CC1CC(O)C(O)C(C(C)(C)C)O1 |
| InChI | InChI=1S/C10H20O3/c1-6-5-7(11)8(12)9(13-6)10(2,3)4/h6-9,11-12H,5H2,1-4H3 |
| InChIKey | HXTIIOXNUWLZOV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |