C11H22O2 — CID 167642620
(3R,5S,6R)-6-tert-butyl-2,5-dimethyloxan-3-ol (PubChem CID 167642620) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (3R,5S,6R)-6-tert-butyl-2,5-dimethyloxan-3-ol.
| Compound Name | (3R,5S,6R)-6-tert-butyl-2,5-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 167642620 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (3R,5S,6R)-6-tert-butyl-2,5-dimethyloxan-3-ol |
| SMILES | CC1O[C@@H](C(C)(C)C)[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C11H22O2/c1-7-6-9(12)8(2)13-10(7)11(3,4)5/h7-10,12H,6H2,1-5H3/t7-,8?,9+,10+/m0/s1 |
| InChIKey | NLZXQNXDGQOKER-NKSXPTFNSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |