C11H18O2 — CID 85427471
6-but-3-ynyl-2,5-dimethyloxan-3-ol (PubChem CID 85427471) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 6-but-3-ynyl-2,5-dimethyloxan-3-ol.
| Compound Name | 6-but-3-ynyl-2,5-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 85427471 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 6-but-3-ynyl-2,5-dimethyloxan-3-ol |
| SMILES | C#CCCC1OC(C)C(O)CC1C |
| InChI | InChI=1S/C11H18O2/c1-4-5-6-11-8(2)7-10(12)9(3)13-11/h1,8-12H,5-7H2,2-3H3 |
| InChIKey | IXMQATPAFUWWFE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|