About (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol
(3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol (PubChem CID 163453977) has the molecular formula C7H14IO3-
and a molecular weight of 273.09 g/mol. Its IUPAC name is (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol.
Molecular Properties
| Compound Name | (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol |
| PubChem CID | 163453977 |
| Molecular Formula | C7H14IO3- |
| Molecular Weight | 273.09 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol |
| SMILES | C[I-][C@@H]1OC(C)[C@H](O)CC1O |
| InChI | InChI=1S/C7H14IO3/c1-4-5(9)3-6(10)7(8-2)11-4/h4-7,9-10H,3H2,1-2H3/q-1/t4?,5-,6?,7-/m1/s1 |
| InChIKey | WBCYPPGGAUPIJX-DHJFATIGSA-N |
| XLogP | -3.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.09 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol?
The IUPAC name of (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol (CID 163453977) is (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol.
What is the SMILES notation for (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol?
The canonical SMILES for (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol is C[I-][C@@H]1OC(C)[C@H](O)CC1O.
What is the InChIKey of (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol?
The InChIKey is WBCYPPGGAUPIJX-DHJFATIGSA-N. The full InChI is InChI=1S/C7H14IO3/c1-4-5(9)3-6(10)7(8-2)11-4/h4-7,9-10H,3H2,1-2H3/q-1/t4?,5-,6?,7-/m1/s1.
What are the key properties of (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol?
(3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol has a molecular weight of 273.09 g/mol, XLogP of -3.44, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol is sourced from PubChem (CID 163453977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).