C7H14IO3- — CID 163453977
(3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol (PubChem CID 163453977) has the molecular formula C7H14IO3- and a molecular weight of 273.09 g/mol. Its IUPAC name is (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol.
| Compound Name | (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol |
|---|---|
| PubChem CID | 163453977 |
| Molecular Formula | C7H14IO3- |
| Molecular Weight | 273.09 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (3R,6S)-2-methyl-6-methyliodanuidyloxane-3,5-diol |
| SMILES | C[I-][C@@H]1OC(C)[C@H](O)CC1O |
| InChI | InChI=1S/C7H14IO3/c1-4-5(9)3-6(10)7(8-2)11-4/h4-7,9-10H,3H2,1-2H3/q-1/t4?,5-,6?,7-/m1/s1 |
| InChIKey | WBCYPPGGAUPIJX-DHJFATIGSA-N |
| XLogP | -3.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.09 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|