C9H22ClNO3 — CID 142409793
[(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium;chloride;hydrate (PubChem CID 142409793) has the molecular formula C9H22ClNO3 and a molecular weight of 227.73 g/mol. Its IUPAC name is [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium;chloride;hydrate.
| Compound Name | [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium;chloride;hydrate |
|---|---|
| PubChem CID | 142409793 |
| Molecular Formula | C9H22ClNO3 |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium;chloride;hydrate |
| SMILES | C[C@@H]1O[C@H](C[N+](C)(C)C)C[C@H]1O.O.[Cl-] |
| InChI | InChI=1S/C9H20NO2.ClH.H2O/c1-7-9(11)5-8(12-7)6-10(2,3)4;;/h7-9,11H,5-6H2,1-4H3;1H;1H2/q+1;;/p-1/t7-,8-,9+;;/m0../s1 |
| InChIKey | DLIBMSFYMQZCQT-DXDZSCKISA-M |
| XLogP | -3.59 |
| TPSA | 60.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|