C26H32PSi+ — CID 177417888
tert-butyl-(1,1-diphenyl-2,3-dihydrophosphindol-1-ium-3-yl)-dimethylsilane (PubChem CID 177417888) has the molecular formula C26H32PSi+ and a molecular weight of 403.60 g/mol. Its IUPAC name is tert-butyl-(1,1-diphenyl-2,3-dihydrophosphindol-1-ium-3-yl)-dimethylsilane.
| Compound Name | tert-butyl-(1,1-diphenyl-2,3-dihydrophosphindol-1-ium-3-yl)-dimethylsilane |
|---|---|
| PubChem CID | 177417888 |
| Molecular Formula | C26H32PSi+ |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | tert-butyl-(1,1-diphenyl-2,3-dihydrophosphindol-1-ium-3-yl)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C1C[P+](c2ccccc2)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H32PSi/c1-26(2,3)28(4,5)25-20-27(21-14-8-6-9-15-21,22-16-10-7-11-17-22)24-19-13-12-18-23(24)25/h6-19,25H,20H2,1-5H3/q+1 |
| InChIKey | IDSXTZWRGWXOGR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|