C27H34OPSi+ — CID 101347825
[3-[tert-butyl(dimethyl)silyl]oxiran-2-yl]methyl-triphenylphosphanium (PubChem CID 101347825) has the molecular formula C27H34OPSi+ and a molecular weight of 433.63 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxiran-2-yl]methyl-triphenylphosphanium.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxiran-2-yl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 101347825 |
| Molecular Formula | C27H34OPSi+ |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxiran-2-yl]methyl-triphenylphosphanium |
| SMILES | CC(C)(C)[Si](C)(C)C1OC1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34OPSi/c1-27(2,3)30(4,5)26-25(28-26)21-29(22-15-9-6-10-16-22,23-17-11-7-12-18-23)24-19-13-8-14-20-24/h6-20,25-26H,21H2,1-5H3/q+1 |
| InChIKey | OMVSATOFXHEKKE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|