About chloromethyl(triphenyl)phosphanium;methanolate
chloromethyl(triphenyl)phosphanium;methanolate (PubChem CID 18356085) has the molecular formula C20H20ClOP
and a molecular weight of 342.81 g/mol. Its IUPAC name is chloromethyl(triphenyl)phosphanium;methanolate.
Molecular Properties
| Compound Name | chloromethyl(triphenyl)phosphanium;methanolate |
| PubChem CID | 18356085 |
| Molecular Formula | C20H20ClOP |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | chloromethyl(triphenyl)phosphanium;methanolate |
| SMILES | C[O-].ClC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17ClP.CH3O/c20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-2/h1-15H,16H2;1H3/q+1;-1 |
| InChIKey | GXHJBCOOXGHQLF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl(triphenyl)phosphanium;methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl(triphenyl)phosphanium;methanolate?
The IUPAC name of chloromethyl(triphenyl)phosphanium;methanolate (CID 18356085) is chloromethyl(triphenyl)phosphanium;methanolate.
What is the SMILES notation for chloromethyl(triphenyl)phosphanium;methanolate?
The canonical SMILES for chloromethyl(triphenyl)phosphanium;methanolate is C[O-].ClC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of chloromethyl(triphenyl)phosphanium;methanolate?
The InChIKey is GXHJBCOOXGHQLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClP.CH3O/c20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-2/h1-15H,16H2;1H3/q+1;-1.
What are the key properties of chloromethyl(triphenyl)phosphanium;methanolate?
chloromethyl(triphenyl)phosphanium;methanolate has a molecular weight of 342.81 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl(triphenyl)phosphanium;methanolate is sourced from PubChem (CID 18356085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).