C59H54P3+3 — CID 101168782
[2-methyl-3-triphenylphosphaniumyl-2-(triphenylphosphaniumylmethyl)propyl]-triphenylphosphanium (PubChem CID 101168782) has the molecular formula C59H54P3+3 and a molecular weight of 856.00 g/mol. Its IUPAC name is [2-methyl-3-triphenylphosphaniumyl-2-(triphenylphosphaniumylmethyl)propyl]-triphenylphosphanium.
| Compound Name | [2-methyl-3-triphenylphosphaniumyl-2-(triphenylphosphaniumylmethyl)propyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 101168782 |
| Molecular Formula | C59H54P3+3 |
| Molecular Weight | 856.00 g/mol |
| Exact Mass | 855.34 |
| IUPAC Name | [2-methyl-3-triphenylphosphaniumyl-2-(triphenylphosphaniumylmethyl)propyl]-triphenylphosphanium |
| SMILES | CC(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C59H54P3/c1-59(47-60(50-29-11-2-12-30-50,51-31-13-3-14-32-51)52-33-15-4-16-34-52,48-61(53-35-17-5-18-36-53,54-37-19-6-20-38-54)55-39-21-7-22-40-55)49-62(56-41-23-8-24-42-56,57-43-25-9-26-44-57)58-45-27-10-28-46-58/h2-46H,47-49H2,1H3/q+3 |
| InChIKey | QSSZYQGKXREJIT-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.00 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|