C24H28FOP — CID 87056097
[(2S)-3-hydroxy-2,3-dimethylbutyl]-triphenylphosphanium fluoride (PubChem CID 87056097) has the molecular formula C24H28FOP and a molecular weight of 382.46 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2,3-dimethylbutyl]-triphenylphosphanium fluoride.
| Compound Name | [(2S)-3-hydroxy-2,3-dimethylbutyl]-triphenylphosphanium fluoride |
|---|---|
| PubChem CID | 87056097 |
| Molecular Formula | C24H28FOP |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [(2S)-3-hydroxy-2,3-dimethylbutyl]-triphenylphosphanium fluoride |
| SMILES | C[C@H](C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)O.[F-] |
| InChI | InChI=1S/C24H28OP.FH/c1-20(24(2,3)25)19-26(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23;/h4-18,20,25H,19H2,1-3H3;1H/q+1;/p-1/t20-;/m1./s1 |
| InChIKey | NFLAQGYUDVKMRG-VEIFNGETSA-M |
| XLogP | 1.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|