C20H18Br2P+ — CID 54589542
2,2-dibromoethyl(triphenyl)phosphanium (PubChem CID 54589542) has the molecular formula C20H18Br2P+ and a molecular weight of 449.15 g/mol. Its IUPAC name is 2,2-dibromoethyl(triphenyl)phosphanium.
| Compound Name | 2,2-dibromoethyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 54589542 |
| Molecular Formula | C20H18Br2P+ |
| Molecular Weight | 449.15 g/mol |
| Exact Mass | 446.95 |
| IUPAC Name | 2,2-dibromoethyl(triphenyl)phosphanium |
| SMILES | BrC(Br)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18Br2P/c21-20(22)16-23(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20H,16H2/q+1 |
| InChIKey | YOIYYCJDJIWRMK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.15 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|