About bromoethane;ethyl(triphenyl)phosphanium;bromide
bromoethane;ethyl(triphenyl)phosphanium;bromide (PubChem CID 174716559) has the molecular formula C22H25Br2P
and a molecular weight of 480.22 g/mol. Its IUPAC name is bromoethane;ethyl(triphenyl)phosphanium;bromide.
Molecular Properties
| Compound Name | bromoethane;ethyl(triphenyl)phosphanium;bromide |
| PubChem CID | 174716559 |
| Molecular Formula | C22H25Br2P |
| Molecular Weight | 480.22 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | bromoethane;ethyl(triphenyl)phosphanium;bromide |
| SMILES | CCBr.CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C20H20P.C2H5Br.BrH/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;1-2-3;/h3-17H,2H2,1H3;2H2,1H3;1H/q+1;;/p-1 |
| InChIKey | IZIGDKSYKQMCPU-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromoethane;ethyl(triphenyl)phosphanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromoethane;ethyl(triphenyl)phosphanium;bromide?
The IUPAC name of bromoethane;ethyl(triphenyl)phosphanium;bromide (CID 174716559) is bromoethane;ethyl(triphenyl)phosphanium;bromide.
What is the SMILES notation for bromoethane;ethyl(triphenyl)phosphanium;bromide?
The canonical SMILES for bromoethane;ethyl(triphenyl)phosphanium;bromide is CCBr.CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-].
What is the InChIKey of bromoethane;ethyl(triphenyl)phosphanium;bromide?
The InChIKey is IZIGDKSYKQMCPU-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H20P.C2H5Br.BrH/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;1-2-3;/h3-17H,2H2,1H3;2H2,1H3;1H/q+1;;/p-1.
What are the key properties of bromoethane;ethyl(triphenyl)phosphanium;bromide?
bromoethane;ethyl(triphenyl)phosphanium;bromide has a molecular weight of 480.22 g/mol, XLogP of 2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromoethane;ethyl(triphenyl)phosphanium;bromide is sourced from PubChem (CID 174716559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).