About ethyl(triphenyl)phosphanium;trifluorocopper(1-)
ethyl(triphenyl)phosphanium;trifluorocopper(1-) (PubChem CID 19429065) has the molecular formula C20H20CuF3P
and a molecular weight of 411.89 g/mol. Its IUPAC name is ethyl(triphenyl)phosphanium;trifluorocopper(1-).
Molecular Properties
| Compound Name | ethyl(triphenyl)phosphanium;trifluorocopper(1-) |
| PubChem CID | 19429065 |
| Molecular Formula | C20H20CuF3P |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | ethyl(triphenyl)phosphanium;trifluorocopper(1-) |
| SMILES | CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[Cu-](F)F |
| InChI | InChI=1S/C20H20P.Cu.3FH/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;;;;/h3-17H,2H2,1H3;;3*1H/q+1;+2;;;/p-3 |
| InChIKey | XSEIPHBLUKPGSZ-UHFFFAOYSA-K |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl(triphenyl)phosphanium;trifluorocopper(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(triphenyl)phosphanium;trifluorocopper(1-)?
The IUPAC name of ethyl(triphenyl)phosphanium;trifluorocopper(1-) (CID 19429065) is ethyl(triphenyl)phosphanium;trifluorocopper(1-).
What is the SMILES notation for ethyl(triphenyl)phosphanium;trifluorocopper(1-)?
The canonical SMILES for ethyl(triphenyl)phosphanium;trifluorocopper(1-) is CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[Cu-](F)F.
What is the InChIKey of ethyl(triphenyl)phosphanium;trifluorocopper(1-)?
The InChIKey is XSEIPHBLUKPGSZ-UHFFFAOYSA-K. The full InChI is InChI=1S/C20H20P.Cu.3FH/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;;;;/h3-17H,2H2,1H3;;3*1H/q+1;+2;;;/p-3.
What are the key properties of ethyl(triphenyl)phosphanium;trifluorocopper(1-)?
ethyl(triphenyl)phosphanium;trifluorocopper(1-) has a molecular weight of 411.89 g/mol, XLogP of 5.26, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(triphenyl)phosphanium;trifluorocopper(1-) is sourced from PubChem (CID 19429065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).